1-adamantyl(amino)acetic acid hydrochloride - Names and Identifiers
Name | amino(tricyclo[3.3.1.1~3,7~]dec-1-yl)acetic acid
|
Synonyms | Albb-007402 AKOS BC-1228 IFLAB-BB F1913-0001 2-(1-Adamantyl)glycine Adamantan-1-Yl-Aminoacetic Acid Adamantan-1-Yl-Amino-Acetic Acid ADAMANTAN-1-YL-AMINO-ACETIC ACID Adamantan-1-Yl(Amino)Acetic Acid 2-(AdaMantan-1-yl)-2-aMinoacetic acid 1-adamantyl(amino)acetic acid hydrochloride amino(tricyclo[3.3.1.1~3,7~]dec-1-yl)acetic acid alpha-Aminotricyclo[3.3.1.13,7]decane-1-acetic acid Tricyclo[3.3.1.1~3,7~]Decane-1-Acetic Acid, Alpha-Amino-
|
CAS | 60256-21-5
|
InChI | InChI=1/C12H19NO2/c13-10(11(14)15)12-4-7-1-8(5-12)3-9(2-7)6-12/h7-10H,1-6,13H2,(H,14,15) |
1-adamantyl(amino)acetic acid hydrochloride - Physico-chemical Properties
Molecular Formula | C12H19NO2
|
Molar Mass | 209.29 |
Density | 1.244 |
Boling Point | 355.6±25.0 °C(Predicted) |
Flash Point | 168.9°C |
Vapor Presure | 5.12E-06mmHg at 25°C |
pKa | 2?+-.0.10(Predicted) |
Storage Condition | 2-8°C(protect from light) |
Refractive Index | 1.586 |
1-adamantyl(amino)acetic acid hydrochloride - Risk and Safety
Hazard Symbols | Xi - Irritant
|
Hazard Class | IRRITANT |
1-adamantyl(amino)acetic acid hydrochloride - Introduction
Amino (tricyclo[3.3.1.1~3,7 ~]dec-1-yl)acetic acid is an organic compound with the chemical formula C11H15NO2. It has the following properties:
1. Appearance: white or off-white crystalline solid;
2. solubility: soluble in water and some organic solvents;
3. melting point: about 134-136 degrees Celsius.
amino(tricyclo[3.3.1.1~3,7 ~]dec-1-yl)acetic acid has many uses, mainly including the following aspects:
1. Drug application: As an amino acid of organic molecules, it can be used as a synthetic intermediate of some drugs for the preparation of antiviral drugs, anti-tumor drugs, etc;
2. Chemical research: It can be used for substrates and reagents in organic synthesis reactions, such as the synthesis of metal complexes, transition metal catalyzed reactions, etc;
3. Surfactant: Due to its hydrophobic and hydrophilic groups, it can be used as a surfactant for industrial applications such as emulsification, dispersion and thickening.
the preparation of amino(tricyclo[3.3.1.1~3,7 ~]dec-1-yl)acetic acid is usually completed by chemical synthesis. A common preparation method is to react adamantanic acid with formaldehyde to form an ester, which is then converted into amino(tricyclo[3.3.1.1~3,7 ~]dec-1-yl) acrylic acid by reductive esterification.
When using and storing amino(tricyclo[3.3.1.1~3,7 ~]dec-1-yl)acetic acid, you need to pay attention to the following safety information:
1. Prevent contact with skin and eyes: This compound may be irritating to skin and eyes, so you need to wear protective gloves and goggles.
2. storage conditions: should be stored in a dry, cool place, away from fire and oxidant.
3. Pay attention to ventilation when using: Because it may release harmful gases, it should be used in a well-ventilated area.
Last Update:2024-04-10 22:39:43